| Compound Information | SONAR Target prediction | | Name: | 6,4--DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500741 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc(cc1)C1Oc2ccc(OC)cc2C(=O)C=1 | | Class: | flavone | | Source: | derivative Cassia spectabilis |
| Species: |
4932 |
| Condition: |
BEM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6473±0.0125158 |
| Normalized OD Score: sc h |
0.7711±0.0208002 |
| Z-Score: |
-6.7362±0.718658 |
| p-Value: |
0.000000000236308 |
| Z-Factor: |
0.235242 |
| Fitness Defect: |
22.1659 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.60 Celcius | | Date: | 2006-03-25 YYYY-MM-DD | | Plate CH Control (+): | 0.0417±0.00147 | | Plate DMSO Control (-): | 0.642325±0.00873 | | Plate Z-Factor: | 0.9398 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 688670 |
6-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 6 | |
|
