Compound Information | SONAR Target prediction | Name: | 6,4--DIMETHOXYFLAVONE | Unique Identifier: | SPE01500741 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(cc1)C1Oc2ccc(OC)cc2C(=O)C=1 | Class: | flavone | Source: | derivative Cassia spectabilis |
Species: |
4932 |
Condition: |
BEM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6473±0.0125158 |
Normalized OD Score: sc h |
0.7711±0.0208002 |
Z-Score: |
-6.7362±0.718658 |
p-Value: |
0.000000000236308 |
Z-Factor: |
0.235242 |
Fitness Defect: |
22.1659 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.60 Celcius | Date: | 2006-03-25 YYYY-MM-DD | Plate CH Control (+): | 0.0417±0.00147 | Plate DMSO Control (-): | 0.642325±0.00873 | Plate Z-Factor: | 0.9398 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688670 |
6-methoxy-2-(4-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 12019 | Additional Members: 25 | Rows returned: 7 | << Back 1 2 |
|