| Compound Information | SONAR Target prediction | | Name: | 8,2`-DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500740 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cccc2C(=O)C=C(Oc12)c1ccccc1OC | | Source: | ex Primula pulverulenta | | Reference: | Phytochemistry 27: 1483 (1988) |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3607±0.00848528 |
| Normalized OD Score: sc h |
0.5623±0.016755 |
| Z-Score: |
-8.5513±0.176204 |
| p-Value: |
1.98281e-17 |
| Z-Factor: |
0.611192 |
| Fitness Defect: |
38.4594 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|D6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.00 Celcius | | Date: | 2006-03-24 YYYY-MM-DD | | Plate CH Control (+): | 0.038425±0.00113 | | Plate DMSO Control (-): | 0.654025±0.02504 | | Plate Z-Factor: | 0.8488 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6708756 |
8-methoxy-2-(2-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 3887 | Additional Members: 4 | Rows returned: 1 | |
|
