Compound Information | SONAR Target prediction | Name: | 8,2`-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500740 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cccc2C(=O)C=C(Oc12)c1ccccc1OC | Source: | ex Primula pulverulenta | Reference: | Phytochemistry 27: 1483 (1988) |
Species: |
4932 |
Condition: |
GCN5 |
Replicates: |
2 |
Raw OD Value: r im |
0.1867±0.00629325 |
Normalized OD Score: sc h |
0.7145±0.0128995 |
Z-Score: |
-4.8948±0.254635 |
p-Value: |
0.00000140391 |
Z-Factor: |
-0.207077 |
Fitness Defect: |
13.4762 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|D6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.30 Celcius | Date: | 2007-10-30 YYYY-MM-DD | Plate CH Control (+): | 0.041249999999999995±0.00086 | Plate DMSO Control (-): | 0.2702±0.02776 | Plate Z-Factor: | 0.6896 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6708756 |
8-methoxy-2-(2-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 3887 | Additional Members: 4 | Rows returned: 1 | |
|