| Compound Information | SONAR Target prediction | | Name: | CHRYSIN DIMETHYL ETHER | | Unique Identifier: | SPE01500739 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cc(OC)c2C(=O)C=C(Oc2c1)c1ccccc1 | | Source: | ex Boesenburgia pandurata, Leptosermum scoparium |
| Species: |
4932 |
| Condition: |
MCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3092±0.0151321 |
| Normalized OD Score: sc h |
0.5335±0.0175139 |
| Z-Score: |
-19.8892±2.30014 |
| p-Value: |
0 |
| Z-Factor: |
-0.460917 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|C7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.60 Celcius | | Date: | 2007-11-13 YYYY-MM-DD | | Plate CH Control (+): | 0.039575±0.00040 | | Plate DMSO Control (-): | 0.5710500000000001±0.10856 | | Plate Z-Factor: | 0.3479 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 88881 |
5,7-dimethoxy-2-phenyl-chromen-4-one |
| 1636405 |
2-phenyl-5,7-bis(phenylmethoxy)chromen-4-one |
| internal high similarity DBLink | Rows returned: 19 | 1 2 3 4 Next >> |
| nonactive | Cluster 4262 | Additional Members: 9 | Rows returned: 4 | |
|