Compound Information | SONAR Target prediction | Name: | CHRYSIN DIMETHYL ETHER | Unique Identifier: | SPE01500739 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc(OC)c2C(=O)C=C(Oc2c1)c1ccccc1 | Source: | ex Boesenburgia pandurata, Leptosermum scoparium |
Species: |
4932 |
Condition: |
NUP100 |
Replicates: |
2 |
Raw OD Value: r im |
0.7297±0.0144957 |
Normalized OD Score: sc h |
0.9671±0.000795405 |
Z-Score: |
-2.2475±0.0714324 |
p-Value: |
0.0247946 |
Z-Factor: |
-92.2484 |
Fitness Defect: |
3.6971 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|C7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.40 Celcius | Date: | 2007-08-28 YYYY-MM-DD | Plate CH Control (+): | 0.04025±0.00122 | Plate DMSO Control (-): | 0.738275±0.13130 | Plate Z-Factor: | 0.4032 |
| png ps pdf |
DBLink | Rows returned: 2 | |
88881 |
5,7-dimethoxy-2-phenyl-chromen-4-one |
1636405 |
2-phenyl-5,7-bis(phenylmethoxy)chromen-4-one |
internal high similarity DBLink | Rows returned: 19 | 1 2 3 4 Next >> |
active | Cluster 4262 | Additional Members: 9 | Rows returned: 2 | |
|