| Compound Information | SONAR Target prediction | | Name: | CHRYSIN DIMETHYL ETHER | | Unique Identifier: | SPE01500739 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cc(OC)c2C(=O)C=C(Oc2c1)c1ccccc1 | | Source: | ex Boesenburgia pandurata, Leptosermum scoparium |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3584±0.0394566 |
| Normalized OD Score: sc h |
0.5105±0.038204 |
| Z-Score: |
-9.5612±0.577498 |
| p-Value: |
2.77472e-20 |
| Z-Factor: |
0.396321 |
| Fitness Defect: |
45.0312 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|C7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.00 Celcius | | Date: | 2006-03-24 YYYY-MM-DD | | Plate CH Control (+): | 0.038575±0.00158 | | Plate DMSO Control (-): | 0.6912±0.04114 | | Plate Z-Factor: | 0.8104 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 88881 |
5,7-dimethoxy-2-phenyl-chromen-4-one |
| 1636405 |
2-phenyl-5,7-bis(phenylmethoxy)chromen-4-one |
| active | Cluster 4262 | Additional Members: 9 | Rows returned: 2 | |
|