| Compound Information | SONAR Target prediction | | Name: | 5,2`-DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500738 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccccc1C1Oc2cccc(OC)c2C(=O)C=1 | | Source: | ex Primula spp |
| Species: |
4932 |
| Condition: |
CDC73 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3127±0.0164049 |
| Normalized OD Score: sc h |
0.7704±0.00778137 |
| Z-Score: |
-5.7863±0.107653 |
| p-Value: |
0.00000000792614 |
| Z-Factor: |
-2.77598 |
| Fitness Defect: |
18.6531 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|C4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.70 Celcius | | Date: | 2007-09-19 YYYY-MM-DD | | Plate CH Control (+): | 0.040249999999999994±0.00037 | | Plate DMSO Control (-): | 0.40585±0.07978 | | Plate Z-Factor: | 0.2653 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 688667 |
5-methoxy-2-(2-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 4 | |
| nonactive | Cluster 4262 | Additional Members: 9 | Rows returned: 4 | |
|
