| Compound Information | SONAR Target prediction |  | Name: | 5,2`-DIMETHOXYFLAVONE |  | Unique Identifier: | SPE01500738  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C17H14O4 |  | Molecular Weight: | 268.18 g/mol |  | X log p: | 17.421  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1ccccc1C1Oc2cccc(OC)c2C(=O)C=1 |  | Source: | ex Primula spp |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BCK1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5002±0.0307591 | 
	 
	
		| Normalized OD Score: sc h | 
		0.7732±0.0164259 | 
	 
	
		| Z-Score: | 
		-4.4291±0.242668 | 
	 
	
		| p-Value: | 
		0.0000124397 | 
	 
	
		| Z-Factor: | 
		0.549856 | 
	 
	
		| Fitness Defect: | 
		11.2946 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 8|C4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.10 Celcius |  | Date: | 2006-03-24 YYYY-MM-DD |  | Plate CH Control (+): | 0.0387±0.00260 |  | Plate DMSO Control (-): | 0.657775±0.01089 |  | Plate Z-Factor: | 0.9119 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 688667 | 
		5-methoxy-2-(2-methoxyphenyl)chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 4262 | Additional Members: 9 | Rows returned: 2 |  |   
 
 |