| Compound Information | SONAR Target prediction | | Name: | 5,2`-DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500738 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccccc1C1Oc2cccc(OC)c2C(=O)C=1 | | Source: | ex Primula spp |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5002±0.0307591 |
| Normalized OD Score: sc h |
0.7732±0.0164259 |
| Z-Score: |
-4.4291±0.242668 |
| p-Value: |
0.0000124397 |
| Z-Factor: |
0.549856 |
| Fitness Defect: |
11.2946 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|C4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2006-03-24 YYYY-MM-DD | | Plate CH Control (+): | 0.0387±0.00260 | | Plate DMSO Control (-): | 0.657775±0.01089 | | Plate Z-Factor: | 0.9119 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 688667 |
5-methoxy-2-(2-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 4262 | Additional Members: 9 | Rows returned: 2 | |
|
