Compound Information | SONAR Target prediction | Name: | 5,2`-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500738 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccccc1C1Oc2cccc(OC)c2C(=O)C=1 | Source: | ex Primula spp |
Species: |
4932 |
Condition: |
KGD1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6902±0.000919239 |
Normalized OD Score: sc h |
1.0084±0.0108998 |
Z-Score: |
0.4886±0.632961 |
p-Value: |
0.65824 |
Z-Factor: |
-11.5723 |
Fitness Defect: |
0.4182 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2007-09-11 YYYY-MM-DD | Plate CH Control (+): | 0.039400000000000004±0.00035 | Plate DMSO Control (-): | 0.6783±0.03949 | Plate Z-Factor: | 0.8045 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688667 |
5-methoxy-2-(2-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 4262 | Additional Members: 9 | Rows returned: 2 | |
|