Compound Information | SONAR Target prediction | Name: | 5,2`-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500738 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccccc1C1Oc2cccc(OC)c2C(=O)C=1 | Source: | ex Primula spp |
Species: |
4932 |
Condition: |
COT1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6880±0.00247487 |
Normalized OD Score: sc h |
0.9920±0.00661254 |
Z-Score: |
-0.4143±0.337486 |
p-Value: |
0.68715 |
Z-Factor: |
-102.582 |
Fitness Defect: |
0.3752 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2007-11-20 YYYY-MM-DD | Plate CH Control (+): | 0.040124999999999994±0.00115 | Plate DMSO Control (-): | 0.679575±0.02438 | Plate Z-Factor: | 0.8860 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688667 |
5-methoxy-2-(2-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 4262 | Additional Members: 9 | Rows returned: 2 | |
|