Compound Information | SONAR Target prediction | Name: | 3,7-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500737 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc2C(=O)C(OC)=C(Oc2c1)c1ccccc1 | Source: | ex Pongamia pinnata |
Species: |
4932 |
Condition: |
GPR1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6016±0.0280014 |
Normalized OD Score: sc h |
0.8300±0.0349282 |
Z-Score: |
-4.7878±0.691849 |
p-Value: |
0.00000865898 |
Z-Factor: |
0.0739974 |
Fitness Defect: |
11.6569 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|D9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2006-03-02 YYYY-MM-DD | Plate CH Control (+): | 0.038525000000000004±0.00060 | Plate DMSO Control (-): | 0.73845±0.01182 | Plate Z-Factor: | 0.9434 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688664 |
3,7-dimethoxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
nonactive | Cluster 16135 | Additional Members: 3 | Rows returned: 2 | |
|