| Compound Information | SONAR Target prediction | | Name: | 3,7-DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500737 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc2C(=O)C(OC)=C(Oc2c1)c1ccccc1 | | Source: | ex Pongamia pinnata |
| Species: |
4932 |
| Condition: |
CLA4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6055±0.00912168 |
| Normalized OD Score: sc h |
0.8944±0.00140487 |
| Z-Score: |
-4.6537±0.119037 |
| p-Value: |
0.0000035244 |
| Z-Factor: |
-1.23598 |
| Fitness Defect: |
12.5558 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|D9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.70 Celcius | | Date: | 2007-09-12 YYYY-MM-DD | | Plate CH Control (+): | 0.040325±0.00053 | | Plate DMSO Control (-): | 0.6646±0.04595 | | Plate Z-Factor: | 0.7654 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 688664 |
3,7-dimethoxy-2-phenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
| nonactive | Cluster 16135 | Additional Members: 3 | Rows returned: 2 | |
|
