Compound Information | SONAR Target prediction | Name: | 3,7-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500737 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc2C(=O)C(OC)=C(Oc2c1)c1ccccc1 | Source: | ex Pongamia pinnata |
Species: |
4932 |
Condition: |
BY4741-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.9250±0 |
Normalized OD Score: sc h |
0.9499±0 |
Z-Score: |
-1.1339±0 |
p-Value: |
0.256848 |
Z-Factor: |
-1.88158 |
Fitness Defect: |
1.3593 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 18|C2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2012-05-28 YYYY-MM-DD | Plate CH Control (+): | 0.1025±0.00506 | Plate DMSO Control (-): | 0.967±0.03080 | Plate Z-Factor: | 0.8756 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688664 |
3,7-dimethoxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 16135 | Additional Members: 3 | Rows returned: 1 | |
|