Compound Information | SONAR Target prediction | Name: | 3,7-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500737 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc2C(=O)C(OC)=C(Oc2c1)c1ccccc1 | Source: | ex Pongamia pinnata |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.3223±0.0236881 |
Normalized OD Score: sc h |
0.9015±0.0228448 |
Z-Score: |
-0.9899±0.0933402 |
p-Value: |
0.323288 |
Z-Factor: |
-1.59743 |
Fitness Defect: |
1.1292 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|D9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2006-02-22 YYYY-MM-DD | Plate CH Control (+): | 0.041675000000000004±0.00148 | Plate DMSO Control (-): | 0.33655±0.02061 | Plate Z-Factor: | 0.7745 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688664 |
3,7-dimethoxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 16135 | Additional Members: 3 | Rows returned: 1 | |
|