| 
 | Compound Information | SONAR Target prediction |  | Name: | 3,7-DIMETHOXYFLAVONE |  | Unique Identifier: | SPE01500737 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C17H14O4 |  | Molecular Weight: | 268.18 g/mol |  | X log p: | 17.421  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1ccc2C(=O)C(OC)=C(Oc2c1)c1ccccc1 |  | Source: | ex Pongamia pinnata | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SET2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6858±0.010253 |  
		| Normalized OD Score: sc h | 0.9695±0.00934804 |  
		| Z-Score: | -1.7864±0.5545 |  
		| p-Value: | 0.0962992 |  
		| Z-Factor: | -3.54973 |  
		| Fitness Defect: | 2.3403 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 6|D9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.70 Celcius |  | Date: | 2007-11-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.040775±0.00090 |  | Plate DMSO Control (-): | 0.703075±0.02940 |  | Plate Z-Factor: | 0.7934 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 688664 | 3,7-dimethoxy-2-phenyl-chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 16135 | Additional Members: 3 | Rows returned: 1 |  | 
 
 |