Compound Information | SONAR Target prediction | Name: | 3,8-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500736 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cccc2C(=O)C(OC)=C(Oc12)c1ccccc1 | Source: | semisynthetic analog |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.5569±0.0373352 |
Normalized OD Score: sc h |
0.7484±0.0226187 |
Z-Score: |
-6.7902±0.369364 |
p-Value: |
0.0000000000339788 |
Z-Factor: |
0.261917 |
Fitness Defect: |
24.1053 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2006-03-14 YYYY-MM-DD | Plate CH Control (+): | 0.039150000000000004±0.00361 | Plate DMSO Control (-): | 0.7119500000000001±0.02881 | Plate Z-Factor: | 0.8479 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6708667 |
3,8-dimethoxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16135 | Additional Members: 3 | Rows returned: 1 | |
|