| Compound Information | SONAR Target prediction | | Name: | 3,8-DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500736 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cccc2C(=O)C(OC)=C(Oc12)c1ccccc1 | | Source: | semisynthetic analog |
| Species: |
4932 |
| Condition: |
FKS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3707±0.00777817 |
| Normalized OD Score: sc h |
0.6899±0.0000634421 |
| Z-Score: |
-5.9546±0.690887 |
| p-Value: |
0.0000000230642 |
| Z-Factor: |
0.467096 |
| Fitness Defect: |
17.585 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|E3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.20 Celcius | | Date: | 2006-04-11 YYYY-MM-DD | | Plate CH Control (+): | 0.0392±0.00155 | | Plate DMSO Control (-): | 0.5412±0.03017 | | Plate Z-Factor: | 0.8324 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6708667 |
3,8-dimethoxy-2-phenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 16135 | Additional Members: 3 | Rows returned: 2 | |
|
