Compound Information | SONAR Target prediction | Name: | 3,8-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500736 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cccc2C(=O)C(OC)=C(Oc12)c1ccccc1 | Source: | semisynthetic analog |
Species: |
4932 |
Condition: |
CTF18 |
Replicates: |
2 |
Raw OD Value: r im |
0.4693±0.0124451 |
Normalized OD Score: sc h |
0.8052±0.0157561 |
Z-Score: |
-8.7511±0.322323 |
p-Value: |
7.89734e-18 |
Z-Factor: |
-2.52717 |
Fitness Defect: |
39.38 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 28.80 Celcius | Date: | 2007-11-01 YYYY-MM-DD | Plate CH Control (+): | 0.044050000000000006±0.00380 | Plate DMSO Control (-): | 0.57535±0.10166 | Plate Z-Factor: | 0.4007 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6708667 |
3,8-dimethoxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16135 | Additional Members: 3 | Rows returned: 1 | |
|