Compound Information | SONAR Target prediction | Name: | 3,8-DIMETHOXYFLAVONE | Unique Identifier: | SPE01500736 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cccc2C(=O)C(OC)=C(Oc12)c1ccccc1 | Source: | semisynthetic analog |
Species: |
4932 |
Condition: |
BY4741-3rd |
Replicates: |
2 |
Raw OD Value: r im |
0.5635±0.0282843 |
Normalized OD Score: sc h |
0.8724±0.0197272 |
Z-Score: |
-6.7446±0.44389 |
p-Value: |
0.0000000000643518 |
Z-Factor: |
-3.99808 |
Fitness Defect: |
23.4667 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.30 Celcius | Date: | 2007-09-25 YYYY-MM-DD | Plate CH Control (+): | 0.03995±0.00044 | Plate DMSO Control (-): | 0.6658±0.12138 | Plate Z-Factor: | 0.3924 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6708667 |
3,8-dimethoxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 16135 | Additional Members: 3 | Rows returned: 2 | |
|