Compound Information | SONAR Target prediction | Name: | 3-,4--DIMETHOXYFLAVONE | Unique Identifier: | SPE01500735 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(cc1OC)C1Oc2ccccc2C(=O)C=1 | Class: | flavone | Source: | Primula officinalis | Reference: | Ber 38: 2177 (1905); Phytochemistry 7: 1215 (1968) |
Species: |
4932 |
Condition: |
MMS22 |
Replicates: |
2 |
Raw OD Value: r im |
0.3149±0.0144957 |
Normalized OD Score: sc h |
0.5967±0.00946677 |
Z-Score: |
-13.2691±1.04783 |
p-Value: |
2.61816e-36 |
Z-Factor: |
0.662807 |
Fitness Defect: |
81.9306 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.00 Celcius | Date: | 2008-06-13 YYYY-MM-DD | Plate CH Control (+): | 0.041325±0.00072 | Plate DMSO Control (-): | 0.5227999999999999±0.01854 | Plate Z-Factor: | 0.8971 |
| png ps pdf |
DBLink | Rows returned: 2 | |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
|