| Compound Information | SONAR Target prediction | | Name: | 3-,4--DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500735 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc(cc1OC)C1Oc2ccccc2C(=O)C=1 | | Class: | flavone | | Source: | Primula officinalis | | Reference: | Ber 38: 2177 (1905); Phytochemistry 7: 1215 (1968) |
| Species: |
4932 |
| Condition: |
POM152 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6744±0.0100409 |
| Normalized OD Score: sc h |
0.9446±0.00197785 |
| Z-Score: |
-2.9216±0.0843904 |
| p-Value: |
0.00354022 |
| Z-Factor: |
-0.816213 |
| Fitness Defect: |
5.6436 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|H7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.80 Celcius | | Date: | 2008-03-15 YYYY-MM-DD | | Plate CH Control (+): | 0.041624999999999995±0.00089 | | Plate DMSO Control (-): | 0.6816±0.02199 | | Plate Z-Factor: | 0.8660 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 12019 | Additional Members: 25 | Rows returned: 7 | 1 2 Next >> |
|
