| Compound Information | SONAR Target prediction | | Name: | 3-,4--DIMETHOXYFLAVONE | | Unique Identifier: | SPE01500735 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc(cc1OC)C1Oc2ccccc2C(=O)C=1 | | Class: | flavone | | Source: | Primula officinalis | | Reference: | Ber 38: 2177 (1905); Phytochemistry 7: 1215 (1968) |
| Species: |
4932 |
| Condition: |
BNI4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7076±0.0492853 |
| Normalized OD Score: sc h |
1.0172±0.00478415 |
| Z-Score: |
0.5387±0.190725 |
| p-Value: |
0.593492 |
| Z-Factor: |
-11.3246 |
| Fitness Defect: |
0.5217 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|F4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.20 Celcius | | Date: | 2006-03-22 YYYY-MM-DD | | Plate CH Control (+): | 0.039525±0.00105 | | Plate DMSO Control (-): | 0.6575±0.04431 | | Plate Z-Factor: | 0.8341 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 12019 | Additional Members: 25 | Rows returned: 7 | 1 2 Next >> |
|
