Compound Information | SONAR Target prediction | Name: | ALPINETIN METHYL ETHER | Unique Identifier: | SPE01500733 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H16O4 | Molecular Weight: | 268.18 g/mol | X log p: | 15.422 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc(OC)c2C(=O)CC(Oc2c1)c1ccccc1 | Source: | ex Eucalyptus spp |
Species: |
4932 |
Condition: |
GIM3 |
Replicates: |
2 |
Raw OD Value: r im |
0.7339±0.0482954 |
Normalized OD Score: sc h |
1.0005±0.00561835 |
Z-Score: |
0.0233±0.178529 |
p-Value: |
0.89957 |
Z-Factor: |
-6.2587 |
Fitness Defect: |
0.1058 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|D4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2006-03-15 YYYY-MM-DD | Plate CH Control (+): | 0.03815±0.00242 | Plate DMSO Control (-): | 0.705475±0.04123 | Plate Z-Factor: | 0.8403 |
| png ps pdf |
DBLink | Rows returned: 3 | |
378567 |
5,7-dimethoxy-2-phenyl-chroman-4-one |
689011 |
(2S)-5,7-dimethoxy-2-phenyl-chroman-4-one |
689012 |
(2R)-5,7-dimethoxy-2-phenyl-chroman-4-one |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 815 | Additional Members: 5 | Rows returned: 0 | |
|