| Compound Information | SONAR Target prediction | | Name: | ALPINETIN METHYL ETHER | | Unique Identifier: | SPE01500733 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H16O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 15.422 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cc(OC)c2C(=O)CC(Oc2c1)c1ccccc1 | | Source: | ex Eucalyptus spp |
| Species: |
4932 |
| Condition: |
DBP3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6698±0.0187383 |
| Normalized OD Score: sc h |
1.0057±0.00228577 |
| Z-Score: |
0.2945±0.107616 |
| p-Value: |
0.769034 |
| Z-Factor: |
-9.1318 |
| Fitness Defect: |
0.2626 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|D4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.90 Celcius | | Date: | 2007-09-13 YYYY-MM-DD | | Plate CH Control (+): | 0.0398±0.00039 | | Plate DMSO Control (-): | 0.6654249999999999±0.02790 | | Plate Z-Factor: | 0.8683 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 378567 |
5,7-dimethoxy-2-phenyl-chroman-4-one |
| 689011 |
(2S)-5,7-dimethoxy-2-phenyl-chroman-4-one |
| 689012 |
(2R)-5,7-dimethoxy-2-phenyl-chroman-4-one |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 815 | Additional Members: 5 | Rows returned: 0 | |
|
