| Compound Information | SONAR Target prediction | | Name: | ALPINETIN METHYL ETHER | | Unique Identifier: | SPE01500733 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H16O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 15.422 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cc(OC)c2C(=O)CC(Oc2c1)c1ccccc1 | | Source: | ex Eucalyptus spp |
| Species: |
4932 |
| Condition: |
BY4741-3rd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.9050±0.027365 |
| Normalized OD Score: sc h |
0.9792±0.018435 |
| Z-Score: |
0.3082±0.756462 |
| p-Value: |
0.60991 |
| Z-Factor: |
-12.465 |
| Fitness Defect: |
0.4944 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 18|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09749999999999999±0.00789 | | Plate DMSO Control (-): | 0.9674999999999999±0.01109 | | Plate Z-Factor: | 0.9352 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 378567 |
5,7-dimethoxy-2-phenyl-chroman-4-one |
| 689011 |
(2S)-5,7-dimethoxy-2-phenyl-chroman-4-one |
| 689012 |
(2R)-5,7-dimethoxy-2-phenyl-chroman-4-one |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 815 | Additional Members: 5 | Rows returned: 0 | |
|
