Compound Information | SONAR Target prediction | Name: | ALPINETIN METHYL ETHER | Unique Identifier: | SPE01500733 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H16O4 | Molecular Weight: | 268.18 g/mol | X log p: | 15.422 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc(OC)c2C(=O)CC(Oc2c1)c1ccccc1 | Source: | ex Eucalyptus spp |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
2 |
Raw OD Value: r im |
0.7315±0.0039598 |
Normalized OD Score: sc h |
0.9543±0.0028606 |
Z-Score: |
-0.5366±0.150387 |
p-Value: |
0.593656 |
Z-Factor: |
-10.3467 |
Fitness Defect: |
0.5215 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 18|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09450000000000001±0.00914 | Plate DMSO Control (-): | 0.95825±0.02624 | Plate Z-Factor: | 0.8663 |
| png ps pdf |
DBLink | Rows returned: 3 | |
378567 |
5,7-dimethoxy-2-phenyl-chroman-4-one |
689011 |
(2S)-5,7-dimethoxy-2-phenyl-chroman-4-one |
689012 |
(2R)-5,7-dimethoxy-2-phenyl-chroman-4-one |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 815 | Additional Members: 5 | Rows returned: 0 | |
|