Compound Information | SONAR Target prediction | Name: | ALPINETIN METHYL ETHER | Unique Identifier: | SPE01500733 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H16O4 | Molecular Weight: | 268.18 g/mol | X log p: | 15.422 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc(OC)c2C(=O)CC(Oc2c1)c1ccccc1 | Source: | ex Eucalyptus spp |
Species: |
4932 |
Condition: |
BNI4 |
Replicates: |
2 |
Raw OD Value: r im |
0.6724±0.0362039 |
Normalized OD Score: sc h |
0.9699±0.00998022 |
Z-Score: |
-0.9458±0.383768 |
p-Value: |
0.3618 |
Z-Factor: |
-2.56775 |
Fitness Defect: |
1.0167 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|D4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2006-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.039525±0.00105 | Plate DMSO Control (-): | 0.6575±0.04431 | Plate Z-Factor: | 0.8341 |
| png ps pdf |
DBLink | Rows returned: 3 | |
378567 |
5,7-dimethoxy-2-phenyl-chroman-4-one |
689011 |
(2S)-5,7-dimethoxy-2-phenyl-chroman-4-one |
689012 |
(2R)-5,7-dimethoxy-2-phenyl-chroman-4-one |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
nonactive | Cluster 815 | Additional Members: 5 | Rows returned: 0 | |
|