Compound Information | SONAR Target prediction | Name: | ALPINETIN METHYL ETHER | Unique Identifier: | SPE01500733 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H16O4 | Molecular Weight: | 268.18 g/mol | X log p: | 15.422 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc(OC)c2C(=O)CC(Oc2c1)c1ccccc1 | Source: | ex Eucalyptus spp |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.5695±0.0072832 |
Normalized OD Score: sc h |
1.0343±0.0190164 |
Z-Score: |
1.5332±0.914444 |
p-Value: |
0.202298 |
Z-Factor: |
-6.71323 |
Fitness Defect: |
1.598 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|D4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.90 Celcius | Date: | 2007-09-27 YYYY-MM-DD | Plate CH Control (+): | 0.039875±0.00027 | Plate DMSO Control (-): | 0.5449999999999999±0.10100 | Plate Z-Factor: | 0.3649 |
| png ps pdf |
DBLink | Rows returned: 3 | |
378567 |
5,7-dimethoxy-2-phenyl-chroman-4-one |
689011 |
(2S)-5,7-dimethoxy-2-phenyl-chroman-4-one |
689012 |
(2R)-5,7-dimethoxy-2-phenyl-chroman-4-one |
internal high similarity DBLink | Rows returned: 11 | << Back 1 2 |
active | Cluster 815 | Additional Members: 5 | Rows returned: 0 | |
|