| Compound Information | SONAR Target prediction |  | Name: | ALPINETIN METHYL ETHER |  | Unique Identifier: | SPE01500733  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C17H16O4 |  | Molecular Weight: | 268.18 g/mol |  | X log p: | 15.422  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1cc(OC)c2C(=O)CC(Oc2c1)c1ccccc1 |  | Source: | ex Eucalyptus spp |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		DUN1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6771±0.00565685 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9885±0.00166102 | 
	 
	
		| Z-Score: | 
		-0.4304±0.0456529 | 
	 
	
		| p-Value: | 
		0.667034 | 
	 
	
		| Z-Factor: | 
		-8.26207 | 
	 
	
		| Fitness Defect: | 
		0.4049 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 8|D4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.80 Celcius |  | Date: | 2006-04-20 YYYY-MM-DD |  | Plate CH Control (+): | 0.039224999999999996±0.00243 |  | Plate DMSO Control (-): | 0.670825±0.01468 |  | Plate Z-Factor: | 0.9335 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 378567 | 
		5,7-dimethoxy-2-phenyl-chroman-4-one | 
	 
	
		| 689011 | 
		(2S)-5,7-dimethoxy-2-phenyl-chroman-4-one | 
	 
	
		| 689012 | 
		(2R)-5,7-dimethoxy-2-phenyl-chroman-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 11 | 1 2 Next >>  |   
 |  active | Cluster 815 | Additional Members: 5 | Rows returned: 0 |  |  
  
 |