| Compound Information | SONAR Target prediction | | Name: | ROBINETIN TRIMETHYL ETHER | | Unique Identifier: | SPE01500732 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C18H16O7 | | Molecular Weight: | 328.188 g/mol | | X log p: | 12.149 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 53.99 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1cc(cc(OC)c1OC)C1Oc2cc(O)ccc2C(=O)C=1O | | Source: | derivative |
| Species: |
4932 |
| Condition: |
DBP3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7040±0.0098995 |
| Normalized OD Score: sc h |
0.9949±0.0061723 |
| Z-Score: |
-0.2721±0.330228 |
| p-Value: |
0.791198 |
| Z-Factor: |
-8.67469 |
| Fitness Defect: |
0.2342 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 22|C2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.30 Celcius | | Date: | 2007-09-13 YYYY-MM-DD | | Plate CH Control (+): | 0.0402±0.00040 | | Plate DMSO Control (-): | 0.6979±0.20781 | | Plate Z-Factor: | -0.0630 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 265724 |
2-(3,4-dimethoxyphenyl)-3-hydroxy-7-methoxy-chromen-4-one |
| 6250403 |
3,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| nonactive | Cluster 15563 | Additional Members: 8 | Rows returned: 3 | |
|