Compound Information | SONAR Target prediction | Name: | ROBINETIN TRIMETHYL ETHER | Unique Identifier: | SPE01500732 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H16O7 | Molecular Weight: | 328.188 g/mol | X log p: | 12.149 (online calculus) | Lipinksi Failures | 1 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1cc(cc(OC)c1OC)C1Oc2cc(O)ccc2C(=O)C=1O | Source: | derivative |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.5601±0.00212132 |
Normalized OD Score: sc h |
1.0008±0.00301468 |
Z-Score: |
0.0387±0.134748 |
p-Value: |
0.924148 |
Z-Factor: |
-6.89353 |
Fitness Defect: |
0.0789 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 22|C2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.70 Celcius | Date: | 2007-09-27 YYYY-MM-DD | Plate CH Control (+): | 0.04055±0.00059 | Plate DMSO Control (-): | 0.5479±0.17599 | Plate Z-Factor: | -0.2046 |
| png ps pdf |
DBLink | Rows returned: 2 | |
265724 |
2-(3,4-dimethoxyphenyl)-3-hydroxy-7-methoxy-chromen-4-one |
6250403 |
3,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 15563 | Additional Members: 8 | Rows returned: 3 | |
|