| 
 | Compound Information | SONAR Target prediction |  | Name: | ROBINETIN TRIMETHYL ETHER |  | Unique Identifier: | SPE01500732 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C18H16O7 |  | Molecular Weight: | 328.188 g/mol |  | X log p: | 12.149  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 53.99 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1cc(cc(OC)c1OC)C1Oc2cc(O)ccc2C(=O)C=1O |  | Source: | derivative | 
 
 
	
		| Species: | 4932 |  
		| Condition: | IDH2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5780±0.000565685 |  
		| Normalized OD Score: sc h | 1.0163±0.00509158 |  
		| Z-Score: | 0.8115±0.235212 |  
		| p-Value: | 0.423462 |  
		| Z-Factor: | -6.14103 |  
		| Fitness Defect: | 0.8593 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 22|C2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.20 Celcius |  | Date: | 2007-10-19 YYYY-MM-DD |  | Plate CH Control (+): | 0.041225±0.00058 |  | Plate DMSO Control (-): | 0.5643750000000001±0.17980 |  | Plate Z-Factor: | -0.2075 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 2 |  | 
 
	
		| 265724 | 2-(3,4-dimethoxyphenyl)-3-hydroxy-7-methoxy-chromen-4-one |  
		| 6250403 | 3,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 11 | 1 2 Next >> | 
 
 | active | Cluster 15563 | Additional Members: 8 | Rows returned: 3 |  | 
 
 |