Compound Information | SONAR Target prediction | Name: | 7,2--DIHYDROXYFLAVONE | Unique Identifier: | SPE01500719 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1ccc2C(=O)C=C(Oc2c1)c1ccccc1O | Class: | flavone | Source: | Primula spp | Therapeutics: | antihaemorrhagic |
Species: |
4932 |
Condition: |
SNC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7110±0.0113137 |
Normalized OD Score: sc h |
0.9853±0.00867417 |
Z-Score: |
-0.8349±0.472027 |
p-Value: |
0.429386 |
Z-Factor: |
-7.48375 |
Fitness Defect: |
0.8454 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 12|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2008-04-24 YYYY-MM-DD | Plate CH Control (+): | 0.0409±0.00089 | Plate DMSO Control (-): | 0.7001999999999999±0.01951 | Plate Z-Factor: | 0.8930 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 13173 | Additional Members: 13 | Rows returned: 3 | |
|