| Compound Information | SONAR Target prediction | | Name: | 7,2--DIHYDROXYFLAVONE | | Unique Identifier: | SPE01500719 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O4 | | Molecular Weight: | 244.158 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | Oc1ccc2C(=O)C=C(Oc2c1)c1ccccc1O | | Class: | flavone | | Source: | Primula spp | | Therapeutics: | antihaemorrhagic |
| Species: |
4932 |
| Condition: |
MT2481-pdr1pdr3-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5299±0.00579828 |
| Normalized OD Score: sc h |
0.9607±0.00809231 |
| Z-Score: |
-1.6545±0.367515 |
| p-Value: |
0.10936 |
| Z-Factor: |
-2.01974 |
| Fitness Defect: |
2.2131 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 12|H6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.00 Celcius | | Date: | 2008-08-22 YYYY-MM-DD | | Plate CH Control (+): | 0.040775000000000006±0.00084 | | Plate DMSO Control (-): | 0.5461750000000001±0.01699 | | Plate Z-Factor: | 0.9005 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 13173 | Additional Members: 13 | Rows returned: 3 | |
|
