| Compound Information | SONAR Target prediction |  | Name: | 7,2--DIHYDROXYFLAVONE |  | Unique Identifier: | SPE01500719  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C15H10O4 |  | Molecular Weight: | 244.158 g/mol |  | X log p: |   (online calculus) |  | Lipinksi Failures |  |  | TPSA |  |  | Hydrogen Bond Donor Count: |  |  | Hydrogen Bond Acceptors Count: |  |  | Rotatable Bond Count: |  |  | Canonical Smiles: | Oc1ccc2C(=O)C=C(Oc2c1)c1ccccc1O |  | Class: | flavone |  | Source: | Primula spp |  | Therapeutics: | antihaemorrhagic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MT2481-pdr1pdr3-1st | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5995±0.0033234 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9778±0.00635348 | 
	 
	
		| Z-Score: | 
		-1.0422±0.3346 | 
	 
	
		| p-Value: | 
		0.310708 | 
	 
	
		| Z-Factor: | 
		-2.8552 | 
	 
	
		| Fitness Defect: | 
		1.1689 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 12|H6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.10 Celcius |  | Date: | 2008-01-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.040249999999999994±0.00028 |  | Plate DMSO Control (-): | 0.595125±0.01303 |  | Plate Z-Factor: | 0.9206 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 0 |  |  
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 13173 | Additional Members: 13 | Rows returned: 3 |  |   
 
 |