Compound Information | SONAR Target prediction | Name: | 7,2--DIHYDROXYFLAVONE | Unique Identifier: | SPE01500719 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1ccc2C(=O)C=C(Oc2c1)c1ccccc1O | Class: | flavone | Source: | Primula spp | Therapeutics: | antihaemorrhagic |
Species: |
4932 |
Condition: |
HSC82 |
Replicates: |
2 |
Raw OD Value: r im |
0.6939±0.00226274 |
Normalized OD Score: sc h |
0.9707±0.00473278 |
Z-Score: |
-1.6285±0.166189 |
p-Value: |
0.105796 |
Z-Factor: |
-1.58598 |
Fitness Defect: |
2.2462 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 12|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2008-04-29 YYYY-MM-DD | Plate CH Control (+): | 0.040825±0.00045 | Plate DMSO Control (-): | 0.7037499999999999±0.01305 | Plate Z-Factor: | 0.9303 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 13173 | Additional Members: 13 | Rows returned: 4 | |
|