Compound Information | SONAR Target prediction | Name: | 6,7-DIHYDROXYFLAVONE | Unique Identifier: | SPE01500718 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2cc1O)c1ccccc1 | Source: | synthetic |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.4213±0.0572756 |
Normalized OD Score: sc h |
0.7907±0.112407 |
Z-Score: |
-5.8578±3.14955 |
p-Value: |
0.000141313 |
Z-Factor: |
-1.31853 |
Fitness Defect: |
8.8645 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2008-06-05 YYYY-MM-DD | Plate CH Control (+): | 0.04055±0.00021 | Plate DMSO Control (-): | 0.5157±0.02128 | Plate Z-Factor: | 0.8318 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 13173 | Additional Members: 13 | Rows returned: 4 | |
|