Compound Information | SONAR Target prediction | Name: | 6,7-DIHYDROXYFLAVONE | Unique Identifier: | SPE01500718 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2cc1O)c1ccccc1 | Source: | synthetic |
Species: |
4932 |
Condition: |
VPH1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3561±0.0302642 |
Normalized OD Score: sc h |
0.7733±0.0665511 |
Z-Score: |
-4.0576±0.956848 |
p-Value: |
0.000362262 |
Z-Factor: |
-0.285974 |
Fitness Defect: |
7.9231 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.90 Celcius | Date: | 2008-03-01 YYYY-MM-DD | Plate CH Control (+): | 0.04045±0.00068 | Plate DMSO Control (-): | 0.415875±0.01304 | Plate Z-Factor: | 0.8560 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 13173 | Additional Members: 13 | Rows returned: 4 | |
|