Compound Information | SONAR Target prediction | Name: | 6,7-DIHYDROXYFLAVONE | Unique Identifier: | SPE01500718 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2cc1O)c1ccccc1 | Source: | synthetic |
Species: |
4932 |
Condition: |
SNC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6731±0.00601041 |
Normalized OD Score: sc h |
0.9487±0.000183492 |
Z-Score: |
-2.9159±0.0636769 |
p-Value: |
0.00358022 |
Z-Factor: |
-0.98692 |
Fitness Defect: |
5.6323 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.80 Celcius | Date: | 2008-04-24 YYYY-MM-DD | Plate CH Control (+): | 0.04095±0.00063 | Plate DMSO Control (-): | 0.7022±0.02205 | Plate Z-Factor: | 0.8808 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 13173 | Additional Members: 13 | Rows returned: 2 | |
|