Compound Information | SONAR Target prediction | Name: | 6,7-DIHYDROXYFLAVONE | Unique Identifier: | SPE01500718 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2cc1O)c1ccccc1 | Source: | synthetic |
Species: |
4932 |
Condition: |
MMS22 |
Replicates: |
2 |
Raw OD Value: r im |
0.5068±0.00325269 |
Normalized OD Score: sc h |
0.9699±0.0218807 |
Z-Score: |
-0.9470±0.640006 |
p-Value: |
0.391338 |
Z-Factor: |
-5.41163 |
Fitness Defect: |
0.9382 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.00 Celcius | Date: | 2008-06-13 YYYY-MM-DD | Plate CH Control (+): | 0.041325±0.00072 | Plate DMSO Control (-): | 0.5227999999999999±0.01854 | Plate Z-Factor: | 0.8971 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 13173 | Additional Members: 13 | Rows returned: 2 | |
|