Compound Information | SONAR Target prediction | Name: | 6,7-DIHYDROXYFLAVONE | Unique Identifier: | SPE01500718 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2cc1O)c1ccccc1 | Source: | synthetic |
Species: |
4932 |
Condition: |
KRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6283±0.00827315 |
Normalized OD Score: sc h |
0.9916±0.00632636 |
Z-Score: |
-0.3560±0.257857 |
p-Value: |
0.726262 |
Z-Factor: |
-26.3795 |
Fitness Defect: |
0.3198 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.40 Celcius | Date: | 2008-04-02 YYYY-MM-DD | Plate CH Control (+): | 0.041825±0.00119 | Plate DMSO Control (-): | 0.6078749999999999±0.01729 | Plate Z-Factor: | 0.9052 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 13173 | Additional Members: 13 | Rows returned: 2 | |
|