| Compound Information | SONAR Target prediction | | Name: | 6,7-DIHYDROXYFLAVONE | | Unique Identifier: | SPE01500718 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O4 | | Molecular Weight: | 244.158 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2cc1O)c1ccccc1 | | Source: | synthetic |
| Species: |
4932 |
| Condition: |
IKI3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6466±0.00502046 |
| Normalized OD Score: sc h |
0.9636±0.00235866 |
| Z-Score: |
-1.7747±0.0339961 |
| p-Value: |
0.0760318 |
| Z-Factor: |
-1.32448 |
| Fitness Defect: |
2.5766 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.30 Celcius | | Date: | 2008-06-12 YYYY-MM-DD | | Plate CH Control (+): | 0.041275±0.00087 | | Plate DMSO Control (-): | 0.6511750000000001±0.01627 | | Plate Z-Factor: | 0.9225 |
| png ps pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 13173 | Additional Members: 13 | Rows returned: 2 | |
|