| Compound Information | SONAR Target prediction | | Name: | 6,7-DIHYDROXYFLAVONE | | Unique Identifier: | SPE01500718 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O4 | | Molecular Weight: | 244.158 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | Oc1cc2OC(=CC(=O)c2cc1O)c1ccccc1 | | Source: | synthetic |
| Species: |
4932 |
| Condition: |
BY4741-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.9420±0 |
| Normalized OD Score: sc h |
0.9730±0.00613982 |
| Z-Score: |
-0.0509±0.316612 |
| p-Value: |
0.823078 |
| Z-Factor: |
-31.7908 |
| Fitness Defect: |
0.1947 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 18|B4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2012-05-28 YYYY-MM-DD | | Plate CH Control (+): | 0.10250000000000001±0.00506 | | Plate DMSO Control (-): | 0.9669999999999999±0.03080 | | Plate Z-Factor: | 0.8756 |
| png ps pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 13173 | Additional Members: 13 | Rows returned: 2 | |
|