Compound Information | SONAR Target prediction | Name: | 6,4--DIHYDROXYFLAVONE | Unique Identifier: | SPE01500717 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2ccc(O)cc2C(=O)C=1 | Class: | flavone | Source: | Cassia spp as glycoside | Therapeutics: | antihaemorrhagic |
Species: |
4932 |
Condition: |
SNC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6846±0.0150614 |
Normalized OD Score: sc h |
0.9715±0.0302838 |
Z-Score: |
-1.6462±1.75833 |
p-Value: |
0.345462 |
Z-Factor: |
-6.4315 |
Fitness Defect: |
1.0629 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.80 Celcius | Date: | 2008-04-24 YYYY-MM-DD | Plate CH Control (+): | 0.04095±0.00063 | Plate DMSO Control (-): | 0.7022±0.02205 | Plate Z-Factor: | 0.8808 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 | |
|