| Compound Information | SONAR Target prediction | | Name: | 6,4--DIHYDROXYFLAVONE | | Unique Identifier: | SPE01500717 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O4 | | Molecular Weight: | 244.158 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2ccc(O)cc2C(=O)C=1 | | Class: | flavone | | Source: | Cassia spp as glycoside | | Therapeutics: | antihaemorrhagic |
| Species: |
4932 |
| Condition: |
RAD23 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6862±0.0046669 |
| Normalized OD Score: sc h |
0.9713±0.0152663 |
| Z-Score: |
-1.4741±0.754873 |
| p-Value: |
0.195852 |
| Z-Factor: |
-3.68651 |
| Fitness Defect: |
1.6304 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2008-02-15 YYYY-MM-DD | | Plate CH Control (+): | 0.041975±0.00086 | | Plate DMSO Control (-): | 0.69435±0.02870 | | Plate Z-Factor: | 0.8197 |
| png ps pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
|