| Compound Information | SONAR Target prediction | | Name: | 6,4--DIHYDROXYFLAVONE | | Unique Identifier: | SPE01500717 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O4 | | Molecular Weight: | 244.158 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2ccc(O)cc2C(=O)C=1 | | Class: | flavone | | Source: | Cassia spp as glycoside | | Therapeutics: | antihaemorrhagic |
| Species: |
4932 |
| Condition: |
MSO1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7057±0.00127279 |
| Normalized OD Score: sc h |
0.9893±0.00395363 |
| Z-Score: |
-0.5242±0.177157 |
| p-Value: |
0.603016 |
| Z-Factor: |
-5.33098 |
| Fitness Defect: |
0.5058 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.40 Celcius | | Date: | 2008-02-27 YYYY-MM-DD | | Plate CH Control (+): | 0.041874999999999996±0.00081 | | Plate DMSO Control (-): | 0.6984999999999999±0.01220 | | Plate Z-Factor: | 0.9441 |
| png ps pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
|