Compound Information | SONAR Target prediction | Name: | 6,4--DIHYDROXYFLAVONE | Unique Identifier: | SPE01500717 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2ccc(O)cc2C(=O)C=1 | Class: | flavone | Source: | Cassia spp as glycoside | Therapeutics: | antihaemorrhagic |
Species: |
4932 |
Condition: |
MRC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6830±0.0108187 |
Normalized OD Score: sc h |
0.9874±0.00947322 |
Z-Score: |
-0.6423±0.494933 |
p-Value: |
0.545528 |
Z-Factor: |
-7.22369 |
Fitness Defect: |
0.606 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.20 Celcius | Date: | 2008-01-15 YYYY-MM-DD | Plate CH Control (+): | 0.044700000000000004±0.00046 | Plate DMSO Control (-): | 0.6777500000000001±0.01565 | Plate Z-Factor: | 0.9130 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
|