| Compound Information | SONAR Target prediction | | Name: | 6,4--DIHYDROXYFLAVONE | | Unique Identifier: | SPE01500717 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O4 | | Molecular Weight: | 244.158 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2ccc(O)cc2C(=O)C=1 | | Class: | flavone | | Source: | Cassia spp as glycoside | | Therapeutics: | antihaemorrhagic |
| Species: |
4932 |
| Condition: |
HHF1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6282±0.00487904 |
| Normalized OD Score: sc h |
0.9360±0.00142706 |
| Z-Score: |
-2.7780±0.0665714 |
| p-Value: |
0.00552118 |
| Z-Factor: |
-0.6679 |
| Fitness Defect: |
5.1992 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.60 Celcius | | Date: | 2008-04-15 YYYY-MM-DD | | Plate CH Control (+): | 0.040725±0.00062 | | Plate DMSO Control (-): | 0.6668499999999999±0.02132 | | Plate Z-Factor: | 0.8946 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
|
