Compound Information | SONAR Target prediction | Name: | 6,4--DIHYDROXYFLAVONE | Unique Identifier: | SPE01500717 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O4 | Molecular Weight: | 244.158 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2ccc(O)cc2C(=O)C=1 | Class: | flavone | Source: | Cassia spp as glycoside | Therapeutics: | antihaemorrhagic |
Species: |
4932 |
Condition: |
BEM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.4625±0.000494975 |
Normalized OD Score: sc h |
0.9634±0.00368368 |
Z-Score: |
-1.0773±0.125674 |
p-Value: |
0.283238 |
Z-Factor: |
-2.51687 |
Fitness Defect: |
1.2615 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 21|H2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2008-02-05 YYYY-MM-DD | Plate CH Control (+): | 0.0432±0.00249 | Plate DMSO Control (-): | 0.46595±0.01726 | Plate Z-Factor: | 0.8173 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
|